C4-CBD
(1′R,2′R)-4-Butyl-5′-methyl-2′-(prop-1-en-2-yl)-1′,2′,3′,4′-tetrahydro[1,1′-biphenyl]-2,6-diol
 4971 C20H28O2 300.435
 Cannabinoid
 InChI=1S/C20H28O2/c1-5-6-7-15-11-18(21)20(19(22)12-15)17-10-14(4)8-9-16(17)13(2)3/h10-12,16-17,21-22H,2,5-9H2,1,3-4H3/t16-,17+/m0/s1
 WBRXESQKGXYDOL-DLBZAZTESA-N This stereoisomer Any stereoisomer
 CCCCc1cc(O)c(c(c1)O)[C@@H]1C=C(C)CC[C@H]1C(=C)C