Δ3-Cannabidiol
3′-Methyl-4-pentyl-6′-(prop-1-en-2-yl)-2′,3′,4′,5′-tetrahydro[1,1′-biphenyl]-2,6-diol
 4969 C21H30O2 314.462
 Cannabinoid
 InChI=1S/C21H30O2/c1-5-6-7-8-16-12-19(22)21(20(23)13-16)18-11-15(4)9-10-17(18)14(2)3/h12-13,15,22-23H,2,5-11H2,1,3-4H3
 YFWFRYYNEQXILR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)c(c(c1)O)C1=C(CCC(C1)C)C(=C)C