Δ6-Cannabidiol
(1′R,2′R)-5′-Methyl-4-pentyl-2′-(prop-1-en-2-yl)-1′,2′,3′,6′-tetrahydro[1,1′-biphenyl]-2,6-diol
 4968 C21H30O2 314.462
 Cannabinoid
 InChI=1S/C21H30O2/c1-5-6-7-8-16-12-19(22)21(20(23)13-16)18-11-15(4)9-10-17(18)14(2)3/h9,12-13,17-18,22-23H,2,5-8,10-11H2,1,3-4H3/t17-,18+/m0/s1
 ZTGXAWYVTLUPDT-ZWKOTPCHSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)c(c(c1)O)[C@@H]1CC(=CC[C@H]1C(=C)C)C