5′-DMA-Δ8THC
(6aR,10aR)-3-[5-(Dimethylamino)pentyl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 4908 C23H35NO2 357.53
 Cannabinoid
 InChI=1S/C23H35NO2/c1-16-10-11-19-18(13-16)22-20(25)14-17(9-7-6-8-12-24(4)5)15-21(22)26-23(19,2)3/h10,14-15,18-19,25H,6-9,11-13H2,1-5H3/t18-,19-/m1/s1
 UGKIIPSFSONYKH-RTBURBONSA-N This stereoisomer Any stereoisomer
 CN(CCCCCc1cc(O)c2c(c1)OC([C@H]1[C@H]2CC(=CC1)C)(C)C)C