WO 2001/058869 #41
(3,4-Dihydroquinolin-1(2H)-yl){2-methyl-1-[2-(morpholin-4-yl)ethyl]-1H-indol-3-yl}methanone
 4842 C25H29N3O2 403.517
 Cannabinoid
 InChI=1S/C25H29N3O2/c1-19-24(25(29)28-12-6-8-20-7-2-4-10-22(20)28)21-9-3-5-11-23(21)27(19)14-13-26-15-17-30-18-16-26/h2-5,7,9-11H,6,8,12-18H2,1H3
 GTHKUKIRNIJVJI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(c1c(C)n(c2c1cccc2)CCN1CCOCC1)N1CCCc2c1cccc2