BzODZ-EPyr
3-(3-Benzyl-1,2,4-oxadiazol-5-yl)-1-[2-(pyrrolidin-1-yl)ethyl]-1H-indole
 4838 C23H24N4O 372.463
 Cannabinoid
 InChI=1S/C23H24N4O/c1-2-8-18(9-3-1)16-22-24-23(28-25-22)20-17-27(15-14-26-12-6-7-13-26)21-11-5-4-10-19(20)21/h1-5,8-11,17H,6-7,12-16H2
 RUVOQWMACBDQDK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 c1ccc(cc1)Cc1noc(n1)c1cn(c2c1cccc2)CCN1CCCC1