MEPIRAPIM
(4-Methylpiperazin-1-yl)(1-pentyl-1H-indol-3-yl)methanone
 4821 C19H27N3O 313.437
 Cannabinoid
 InChI=1S/C19H27N3O/c1-3-4-7-10-22-15-17(16-8-5-6-9-18(16)22)19(23)21-13-11-20(2)12-14-21/h5-6,8-9,15H,3-4,7,10-14H2,1-2H3
 IUEFFEOHJKCBPF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCn1cc(c2c1cccc2)C(=O)N1CCN(CC1)C