ψ-MFEM
1-[4-(2-Fluoroethoxy)-2,6-dimethoxyphenyl]propan-2-amine
 477 C13H20FNO3 257.301
 InChI=1S/C13H20FNO3/c1-9(15)6-11-12(16-2)7-10(18-5-4-14)8-13(11)17-3/h7-9H,4-6,15H2,1-3H3
 ZWTSZKWQJSFARQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 FCCOc1cc(OC)c(c(c1)OC)CC(N)C