US 4371720 #1-20
2-[(1R,2S,5R)-5-Hydroxy-2-(2-hydroxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol
 4760 C24H40O3 376.573
 Cannabinoid
 InChI=1S/C24H40O3/c1-5-6-7-8-13-24(3,4)19-10-12-21(23(27)15-19)22-16-20(26)11-9-18(22)14-17(2)25/h10,12,15,17-18,20,22,25-27H,5-9,11,13-14,16H2,1-4H3/t17?,18-,20+,22+/m0/s1
 DONAUCHZHBMXPL-XJJAIOEASA-N This stereoisomer Any stereoisomer
 CCCCCCC(c1ccc(c(c1)O)[C@@H]1C[C@H](O)CC[C@H]1CC(O)C)(C)C