MDA-19
N′-(1-Hexyl-2-oxo-1,2-dihydro-3H-indol-3-ylidene)benzohydrazide
 4717 C21H23N3O2 349.426
 Cannabinoid
 InChI=1S/C21H23N3O2/c1-2-3-4-10-15-24-18-14-9-8-13-17(18)19(21(24)26)22-23-20(25)16-11-6-5-7-12-16/h5-9,11-14H,2-4,10,15H2,1H3,(H,23,25)/b22-19-
 ZGQHMZCITJHYOW-QOCHGBHMSA-N This stereoisomer Any stereoisomer
 CCCCCCN1C(=O)/C(=N\NC(=O)c2ccccc2)/c2c1cccc2