C6-UR-144
(1-Hexyl-1H-indol-3-yl)(2,2,3,3-tetramethylcyclopropyl)methanone
 4699 C22H31NO 325.488
 Cannabinoid
 InChI=1S/C22H31NO/c1-6-7-8-11-14-23-15-17(16-12-9-10-13-18(16)23)19(24)20-21(2,3)22(20,4)5/h9-10,12-13,15,20H,6-8,11,14H2,1-5H3
 FDYFSCXGRYOQJZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCn1cc(c2c1cccc2)C(=O)C1C(C1(C)C)(C)C