C3-UR-144
(1-Propyl-1H-indol-3-yl)(2,2,3,3-tetramethylcyclopropyl)methanone
 4698 C19H25NO 283.408
 Cannabinoid
 InChI=1S/C19H25NO/c1-6-11-20-12-14(13-9-7-8-10-15(13)20)16(21)17-18(2,3)19(17,4)5/h7-10,12,17H,6,11H2,1-5H3
 BKFRFHCIZQYHLV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCn1cc(c2c1cccc2)C(=O)C1C(C1(C)C)(C)C