Δ8-THC-1,2-DMH
(6aR,10aR)-6,6,9-Trimethyl-3-[(2S,3R)-3-methyloctan-2-yl]-6a,7,10,10a-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 4650 C25H38O2 370.568
 Cannabinoid
 InChI=1S/C25H38O2/c1-7-8-9-10-17(3)18(4)19-14-22(26)24-20-13-16(2)11-12-21(20)25(5,6)27-23(24)15-19/h11,14-15,17-18,20-21,26H,7-10,12-13H2,1-6H3/t17-,18+,20-,21-/m1/s1
 XAUNJOUEWQWLCP-KOUHRCEDSA-N This stereoisomer Any stereoisomer
 CCCCC[C@H]([C@@H](c1cc(O)c2c(c1)OC([C@H]1[C@H]2CC(=CC1)C)(C)C)C)C