2C-O-21.5
2-[4-(2,2-Difluoroethoxy)-2,5-dimethoxyphenyl]ethan-1-amine
 465 C12H17F2NO3 261.265
 InChI=1S/C12H17F2NO3/c1-16-9-6-11(18-7-12(13)14)10(17-2)5-8(9)3-4-15/h5-6,12H,3-4,7,15H2,1-2H3
 USTOBZVLZKAMKI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)OCC(F)F