EA-2233-2
(9R)-6,6,9-Trimethyl-3-[(2S,3R)-3-methyloctan-2-yl]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-1-yl acetate
 4634 C27H40O3 412.605
 Cannabinoid
 InChI=1S/C27H40O3/c1-8-9-10-11-18(3)19(4)21-15-24(29-20(5)28)26-22-14-17(2)12-13-23(22)27(6,7)30-25(26)16-21/h15-19H,8-14H2,1-7H3/t17-,18-,19+/m1/s1
 RFIQQBXUDNGUKS-QRVBRYPASA-N This stereoisomer Any stereoisomer
 CCCCC[C@H]([C@@H](c1cc(OC(=O)C)c2c(c1)OC(C1=C2C[C@H](C)CC1)(C)C)C)C