Δ7-THC
(6aR,10aR)-6,6,9-Trimethyl-3-pentyl-6a,9,10,10a-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 4622 C21H30O2 314.462
 Cannabinoid
 InChI=1S/C21H30O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h9-10,12-14,16-17,22H,5-8,11H2,1-4H3/t14?,16-,17-/m1/s1
 WWYMYGIVLCKTBL-VNCLPFQGSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)c2c(c1)OC([C@H]1[C@H]2CC(C)C=C1)(C)C