Δ2-THC
(6aR)-6,6,9-Trimethyl-3-pentyl-6a,7,8,9-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 4621 C21H30O2 314.462
 Cannabinoid
 InChI=1S/C21H30O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h11-14,17,22H,5-10H2,1-4H3/t14?,17-/m1/s1
 YLTWYAXWDLZZCU-FBMWCMRBSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)c2c(c1)OC([C@H]1C2=CC(C)CC1)(C)C