Δ3-THC
6,6,9-Trimethyl-3-pentyl-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 4620 C21H30O2 314.462
 Cannabinoid
 InChI=1S/C21H30O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h12-14,22H,5-11H2,1-4H3
 NEBZNJDFIPBXCS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCc1cc(O)c2c(c1)OC(C1=C2CC(C)CC1)(C)C