C7-Δ9-THC
(6aR,10aR)-3-Heptyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 4614 C23H34O2 342.515
 Cannabinoid
 InChI=1S/C23H34O2/c1-5-6-7-8-9-10-17-14-20(24)22-18-13-16(2)11-12-19(18)23(3,4)25-21(22)15-17/h13-15,18-19,24H,5-12H2,1-4H3/t18-,19-/m1/s1
 OJTMRZHYTZMJKX-RTBURBONSA-N This stereoisomer Any stereoisomer
 CCCCCCCc1cc(O)c2c(c1)OC([C@H]1[C@H]2C=C(C)CC1)(C)C