C6-Δ9-THC
(6aR,10aR)-3-Hexyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydro-6H-dibenzo[b,d]pyran-1-ol
 4613 C22H32O2 328.488
 Cannabinoid
 InChI=1S/C22H32O2/c1-5-6-7-8-9-16-13-19(23)21-17-12-15(2)10-11-18(17)22(3,4)24-20(21)14-16/h12-14,17-18,23H,5-11H2,1-4H3/t17-,18-/m1/s1
 DMJVNNFBMZZLFB-QZTJIDSGSA-N This stereoisomer Any stereoisomer
 CCCCCCc1cc(O)c2c(c1)OC([C@H]1[C@H]2C=C(C)CC1)(C)C