CBD-004
N-(Adamantan-1-yl)-3-(morpholine-4-sulfonyl)benzamide
 4554 C21H28N2O4S 404.523
 Cannabinoid
 InChI=1S/C21H28N2O4S/c24-20(22-21-12-15-8-16(13-21)10-17(9-15)14-21)18-2-1-3-19(11-18)28(25,26)23-4-6-27-7-5-23/h1-3,11,15-17H,4-10,12-14H2,(H,22,24)
 UBXHPACTFCRXMP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(c1cccc(c1)S(=O)(=O)N1CCOCC1)NC12CC3CC(C2)CC(C1)C3