CBD-021
N-(Cyclohexylmethyl)-3-(piperidine-1-sulfonyl)benzamide
 4553 C19H28N2O3S 364.502
 Cannabinoid
 InChI=1S/C19H28N2O3S/c22-19(20-15-16-8-3-1-4-9-16)17-10-7-11-18(14-17)25(23,24)21-12-5-2-6-13-21/h7,10-11,14,16H,1-6,8-9,12-13,15H2,(H,20,22)
 QAOBOCYDBUFPDT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(c1cccc(c1)S(=O)(=O)N1CCCCC1)NCC1CCCCC1