DOB-NEt
1-(4-Bromo-2,5-dimethoxyphenyl)-N-ethylpropan-2-amine
 443 C13H20BrNO2 302.207
 InChI=1S/C13H20BrNO2/c1-5-15-9(2)6-10-7-13(17-4)11(14)8-12(10)16-3/h7-9,15H,5-6H2,1-4H3
 SMLWLIUZFXEVAQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1cc(OC)c(cc1OC)Br)C