β-MeO-DOB
1-(4-Bromo-2,5-dimethoxyphenyl)-1-methoxypropan-2-amine
 442 C12H18BrNO3 304.18
 InChI=1S/C12H18BrNO3/c1-7(14)12(17-4)8-5-11(16-3)9(13)6-10(8)15-2/h5-7,12H,14H2,1-4H3
 JZRYUHHXNUHBTB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(cc1C(C(N)C)OC)OC