β-HO-DOB
2-Amino-1-(4-bromo-2,5-dimethoxyphenyl)propan-1-ol
 441 C11H16BrNO3 290.154
 InChI=1S/C11H16BrNO3/c1-6(13)11(14)7-4-10(16-3)8(12)5-9(7)15-2/h4-6,11,14H,13H2,1-3H3
 YLLHAHHNKOUOSR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(cc1C(C(N)C)O)OC