5-MeO-NET
N-Ethyl-2-(5-methoxy-1H-indol-3-yl)ethan-1-amine
 429 C13H18N2O 218.295
 InChI=1S/C13H18N2O/c1-3-14-7-6-10-9-15-13-5-4-11(16-2)8-12(10)13/h4-5,8-9,14-15H,3,6-7H2,1-2H3
 UNPLGMNGAFLKSH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCc1c[nH]c2c1cc(OC)cc2