(Pentenyl) JWH-149
(4-Methylnaphthalen-1-yl)[2-methyl-1-(pent-4-en-1-yl)-1H-indol-3-yl]methanone
 4139  C26H25NO  367.483
 Cannabinoid
 InChI=1S/C26H25NO/c1-4-5-10-17-27-19(3)25(23-13-8-9-14-24(23)27)26(28)22-16-15-18(2)20-11-6-7-12-21(20)22/h4,6-9,11-16H,1,5,10,17H2,2-3H3
 BHIDJUOUNKKESL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCCCn1c(C)c(c2c1cccc2)C(=O)c1ccc(c2c1cccc2)C