pip-2C-B
1-[2-(4-Bromo-2,5-dimethoxyphenyl)ethyl]piperidine
 396 C15H22BrNO2 328.245
 InChI=1S/C15H22BrNO2/c1-18-14-11-13(16)15(19-2)10-12(14)6-9-17-7-4-3-5-8-17/h10-11H,3-9H2,1-2H3
 HCAIUSZHAJZMDI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(cc1CCN1CCCCC1)OC