6-MeO-5-APDB
1-(6-Methoxy-2,3-dihydro-1-benzofuran-5-yl)propan-2-amine
 3931 C12H17NO2 207.269
 InChI=1S/C12H17NO2/c1-8(13)5-10-6-9-3-4-15-12(9)7-11(10)14-2/h6-8H,3-5,13H2,1-2H3
 QTFKMWSZTKGNIO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc2OCCc2cc1CC(N)C