2-[5-(4-Phenylpiperazin-1-yl)pentyl]-1H-isoindole-1,3(2H)-dione
 3810 C23H27N3O2 377.479
 InChI=1S/C23H27N3O2/c27-22-20-11-5-6-12-21(20)23(28)26(22)14-8-2-7-13-24-15-17-25(18-16-24)19-9-3-1-4-10-19/h1,3-6,9-12H,2,7-8,13-18H2
 YRCZJVPFEIPMMN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C1N(CCCCCN2CCN(CC2)c2ccccc2)C(=O)c2c1cccc2