2-[3-(4-Phenylpiperazin-1-yl)propyl]-1H-isoindole-1,3(2H)-dione
 3808 C21H23N3O2 349.426
 InChI=1S/C21H23N3O2/c25-20-18-9-4-5-10-19(18)21(26)24(20)12-6-11-22-13-15-23(16-14-22)17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2
 IXYMLHRXRRYXSJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C1N(CCCN2CCN(CC2)c2ccccc2)C(=O)c2c1cccc2