6-Chloro-2-(chloromethyl)-3-oxo-4-phenyl-3λ5-quinazoline
 3767 C15H10Cl2N2O 305.159
 Prophetic?
 InChI=1S/C15H10Cl2N2O/c16-9-14-18-13-7-6-11(17)8-12(13)15(19(14)20)10-4-2-1-3-5-10/h1-8H,9H2
 KFDNKXWSTFABQT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ClCc1nc2ccc(cc2c(n1=O)c1ccccc1)Cl