4-MeO-CPDPA
2-(4-Methoxyphenyl)-N,N-dipropylcyclopropan-1-amine
 3622 C16H25NO 247.376
 InChI=1S/C16H25NO/c1-4-10-17(11-5-2)16-12-15(16)13-6-8-14(18-3)9-7-13/h6-9,15-16H,4-5,10-12H2,1-3H3
 YOQFWJPWSAUTKG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C1CC1c1ccc(cc1)OC)CCC