2C-B-2-hemidragonFLY
2-(4-Bromo-5-methoxy-1-benzofuran-7-yl)ethan-1-amine
 351 C11H12BrNO2 270.122
 InChI=1S/C11H12BrNO2/c1-14-9-6-7(2-4-13)11-8(10(9)12)3-5-15-11/h3,5-6H,2,4,13H2,1H3
 LBGNZFDTQWYJRK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c2c1occ2)Br