2C-B-5-hemidragonFLY
2-(7-Bromo-5-methoxy-1-benzofuran-4-yl)ethan-1-amine
 350 C11H12BrNO2 270.122
 InChI=1S/C11H12BrNO2/c1-14-10-6-9(12)11-8(3-5-15-11)7(10)2-4-13/h3,5-6H,2,4,13H2,1H3
 CETFLDUKQZUEGP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)cc(c2c1cco2)Br