Trimeperidine
1,2,5-Trimethyl-4-phenylpiperidin-4-yl propanoate
 3269 C17H25NO2 275.386
 InChI=1S/C17H25NO2/c1-5-16(19)20-17(15-9-7-6-8-10-15)11-14(3)18(4)12-13(17)2/h6-10,13-14H,5,11-12H2,1-4H3
 UVITTYOJFDLOGI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)OC1(CC(C)N(CC1C)C)c1ccccc1