Piminodine
Ethyl 1-(3-anilinopropyl)-4-phenylpiperidine-4-carboxylate
 3267 C23H30N2O2 366.497
 InChI=1S/C23H30N2O2/c1-2-27-22(26)23(20-10-5-3-6-11-20)14-18-25(19-15-23)17-9-16-24-21-12-7-4-8-13-21/h3-8,10-13,24H,2,9,14-19H2,1H3
 PXXKIYPSXYFATG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOC(=O)C1(CCN(CC1)CCCNc1ccccc1)c1ccccc1