Pharaohfentanyl
N-[1-(2-Hydroxy-2-phenylethyl)-4-methylpiperidin-4-yl]-N-phenylpropanamide
 3191 C23H30N2O2 366.497
 Fentanyl
 InChI=1S/C23H30N2O2/c1-3-22(27)25(20-12-8-5-9-13-20)23(2)14-16-24(17-15-23)18-21(26)19-10-6-4-7-11-19/h4-13,21,26H,3,14-18H2,1-2H3
 WXLDNZGFFHXCAW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(=O)N(C1(C)CCN(CC1)CC(c1ccccc1)O)c1ccccc1