6-(2-Aminopropyl)-2-ethyl-5-methoxy-2,3-dihydrobenzofuran
1-(2-Ethyl-5-methoxy-2,3-dihydro-1-benzofuran-6-yl)propan-2-amine
 316 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-4-12-6-11-7-13(16-3)10(5-9(2)15)8-14(11)17-12/h7-9,12H,4-6,15H2,1-3H3
 XPXNBUIFYXLYPU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC1Cc2c(O1)cc(c(c2)OC)CC(N)C