Diphenpipenol
3-{(2S)-2-[4-(2-Methoxyphenyl)piperazin-1-yl]-2-phenylethyl}phenol
 3148 C25H28N2O2 388.502
 InChI=1S/C25H28N2O2/c1-29-25-13-6-5-12-23(25)26-14-16-27(17-15-26)24(21-9-3-2-4-10-21)19-20-8-7-11-22(28)18-20/h2-13,18,24,28H,14-17,19H2,1H3/t24-/m0/s1
 ILCZMFSACNEMGK-DEOSSOPVSA-N This stereoisomer Any stereoisomer
 COc1ccccc1N1CCN(CC1)[C@H](c1ccccc1)Cc1cccc(c1)O