7-(2-Aminopropyl)-5-methoxy-2-methyl-2,3-dihydrobenzofuran
1-(5-Methoxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)propan-2-amine
 314 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-8(14)4-10-6-12(15-3)7-11-5-9(2)16-13(10)11/h6-9H,4-5,14H2,1-3H3
 IBFJVGPRQANQNU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c2c(c1)CC(O2)C