4Br-α-PPP
1-(4-Bromophenyl)-2-(pyrrolidin-1-yl)propan-1-one
 2980  C13H16BrNO  282.176
 InChI=1S/C13H16BrNO/c1-10(15-8-2-3-9-15)13(16)11-4-6-12(14)7-5-11/h4-7,10H,2-3,8-9H2,1H3
 RVBBEFQXBCFNJA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(=O)c1ccc(cc1)Br)N1CCCC1