Phenmetetrazine
3-Ethyl-4-methyl-2-phenylmorpholine
 2976  C13H19NO  205.296
 InChI=1S/C13H19NO/c1-3-12-13(15-10-9-14(12)2)11-7-5-4-6-8-11/h4-8,12-13H,3,9-10H2,1-2H3
 AGZZVDZENOKVTN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC1N(C)CCOC1c1ccccc1