N-(2,6-Dimethylphenyl)-2-(piperidin-1-yl)acetamide
 2950 C15H22N2O 246.348
 InChI=1S/C15H22N2O/c1-12-7-6-8-13(2)15(12)16-14(18)11-17-9-4-3-5-10-17/h6-8H,3-5,9-11H2,1-2H3,(H,16,18)
 OVECJQXXUIVZBI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(Nc1c(C)cccc1C)CN1CCCCC1