Cloroqualone
3-(2,6-Dichlorophenyl)-2-ethylquinazolin-4(3H)-one
 2941 C16H12Cl2N2O 319.185
 InChI=1S/C16H12Cl2N2O/c1-2-14-19-13-9-4-3-6-10(13)16(21)20(14)15-11(17)7-5-8-12(15)18/h3-9H,2H2,1H3
 SONHVLIDLXLSOL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCc1nc2ccccc2c(=O)n1c1c(Cl)cccc1Cl