α-Acetoxy-2C-D
1-Amino-2-(2,5-dimethoxy-4-methylphenyl)ethyl acetate
 2922 C13H19NO4 253.294
 InChI=1S/C13H19NO4/c1-8-5-12(17-4)10(6-11(8)16-3)7-13(14)18-9(2)15/h5-6,13H,7,14H2,1-4H3
 XXJYYGQZQFTHNL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(cc1CC(OC(=O)C)N)OC