3-Methyl phenoxy acetylfentanil
N-[3-Methyl-1-(2-phenoxyethyl)piperidin-4-yl]-N-phenylacetamide
 2890 C22H28N2O2 352.47
 Fentanyl
 InChI=1S/C22H28N2O2/c1-18-17-23(15-16-26-21-11-7-4-8-12-21)14-13-22(18)24(19(2)25)20-9-5-3-6-10-20/h3-12,18,22H,13-17H2,1-2H3
 BMKBNQJKTAKNHB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1CN(CCOc2ccccc2)CCC1N(c1ccccc1)C(=O)C