2,6-DMeA
1-(2,6-Dimethylphenyl)propan-2-amine
 2800 C11H17N 163.259
 InChI=1S/C11H17N/c1-8-5-4-6-9(2)11(8)7-10(3)12/h4-6,10H,7,12H2,1-3H3
 TZFMIERDLHYNCJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c(C)cccc1C)N