N-Acetyl 2,5-DMA
N-[1-(2,5-Dimethoxyphenyl)propan-2-yl]acetamide
 2775 C13H19NO3 237.295
 InChI=1S/C13H19NO3/c1-9(14-10(2)15)7-11-8-12(16-3)5-6-13(11)17-4/h5-6,8-9H,7H2,1-4H3,(H,14,15)
 MXPMBGGXIDITOG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1CC(NC(=O)C)C)OC