N-Acetyl TMA-2
N-[1-(2,4,5-Trimethoxyphenyl)propan-2-yl]acetamide
 2771  C14H21NO4  267.321
 InChI=1S/C14H21NO4/c1-9(15-10(2)16)6-11-7-13(18-4)14(19-5)8-12(11)17-3/h7-9H,6H2,1-5H3,(H,15,16)
 QKUOENPMXPKEGX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC)c(cc1CC(NC(=O)C)C)OC